C23H36O3 — CID 45276648
(1R,3S,3aR,6aS)-5',5'-dimethyl-1,3-bis(3-methylbut-2-enyl)spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one (PubChem CID 45276648) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (1R,3S,3aR,6aS)-5',5'-dimethyl-1,3-bis(3-methylbut-2-enyl)spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one.
| Compound Name | (1R,3S,3aR,6aS)-5',5'-dimethyl-1,3-bis(3-methylbut-2-enyl)spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one |
|---|---|
| PubChem CID | 45276648 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (1R,3S,3aR,6aS)-5',5'-dimethyl-1,3-bis(3-methylbut-2-enyl)spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one |
| SMILES | CC(C)=CC[C@@H]1C(=O)[C@H](CC=C(C)C)[C@H]2CC3(C[C@H]21)OCC(C)(C)CO3 |
| InChI | InChI=1S/C23H36O3/c1-15(2)7-9-17-19-11-23(25-13-22(5,6)14-26-23)12-20(19)18(21(17)24)10-8-16(3)4/h7-8,17-20H,9-14H2,1-6H3/t17-,18+,19-,20+ |
| InChIKey | OBCZOJWFFCOJNB-FGYAAKKASA-N |
| XLogP | 5.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|