C21H36GeO3 — CID 135049099
(1'S,3'aS,6'aR)-5,5-dimethyl-1'-(3-trimethylgermylbut-3-enyl)spiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde (PubChem CID 135049099) has the molecular formula C21H36GeO3 and a molecular weight of 409.13 g/mol. Its IUPAC name is (1'S,3'aS,6'aR)-5,5-dimethyl-1'-(3-trimethylgermylbut-3-enyl)spiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde.
| Compound Name | (1'S,3'aS,6'aR)-5,5-dimethyl-1'-(3-trimethylgermylbut-3-enyl)spiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde |
|---|---|
| PubChem CID | 135049099 |
| Molecular Formula | C21H36GeO3 |
| Molecular Weight | 409.13 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | (1'S,3'aS,6'aR)-5,5-dimethyl-1'-(3-trimethylgermylbut-3-enyl)spiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde |
| SMILES | C=C(CC[C@@H]1C(C=O)C[C@H]2CC3(C[C@H]21)OCC(C)(C)CO3)[Ge](C)(C)C |
| InChI | InChI=1S/C21H36GeO3/c1-15(22(4,5)6)7-8-18-17(12-23)9-16-10-21(11-19(16)18)24-13-20(2,3)14-25-21/h12,16-19H,1,7-11,13-14H2,2-6H3/t16-,17?,18+,19+/m0/s1 |
| InChIKey | DTURSDQQYOWOFX-GCWMRRSQSA-N |
| XLogP | 4.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.13 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|