C20H34O3Sn — CID 11826337
(1'S,2'S,3'aS,6'aR)-5,5-dimethyl-1'-(2-trimethylstannylprop-2-enyl)spiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde (PubChem CID 11826337) has the molecular formula C20H34O3Sn and a molecular weight of 441.20 g/mol. Its IUPAC name is (1'S,2'S,3'aS,6'aR)-5,5-dimethyl-1'-(2-trimethylstannylprop-2-enyl)spiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde.
| Compound Name | (1'S,2'S,3'aS,6'aR)-5,5-dimethyl-1'-(2-trimethylstannylprop-2-enyl)spiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde |
|---|---|
| PubChem CID | 11826337 |
| Molecular Formula | C20H34O3Sn |
| Molecular Weight | 441.20 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | (1'S,2'S,3'aS,6'aR)-5,5-dimethyl-1'-(2-trimethylstannylprop-2-enyl)spiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde |
| SMILES | C=C(C[C@H]1[C@@H]2CC3(C[C@@H]2C[C@@H]1C=O)OCC(C)(C)CO3)[Sn](C)(C)C |
| InChI | InChI=1S/C17H25O3.3CH3.Sn/c1-4-5-14-13(9-18)6-12-7-17(8-15(12)14)19-10-16(2,3)11-20-17;;;;/h9,12-15H,1,5-8,10-11H2,2-3H3;3*1H3;/t12-,13+,14+,15+;;;;/m0..../s1 |
| InChIKey | VRFYKZZHDMBYIL-LPCJJZFMSA-N |
| XLogP | 4.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.20 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|