C19H28O3 — CID 45276647
(1S,3R,3aS,6aR)-5',5'-dimethyl-1,3-bis(prop-2-enyl)spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one (PubChem CID 45276647) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (1S,3R,3aS,6aR)-5',5'-dimethyl-1,3-bis(prop-2-enyl)spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one.
| Compound Name | (1S,3R,3aS,6aR)-5',5'-dimethyl-1,3-bis(prop-2-enyl)spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one |
|---|---|
| PubChem CID | 45276647 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1S,3R,3aS,6aR)-5',5'-dimethyl-1,3-bis(prop-2-enyl)spiro[1,3,3a,4,6,6a-hexahydropentalene-5,2'-1,3-dioxane]-2-one |
| SMILES | C=CC[C@@H]1C(=O)[C@H](CC=C)[C@H]2CC3(C[C@H]21)OCC(C)(C)CO3 |
| InChI | InChI=1S/C19H28O3/c1-5-7-13-15-9-19(21-11-18(3,4)12-22-19)10-16(15)14(8-6-2)17(13)20/h5-6,13-16H,1-2,7-12H2,3-4H3/t13-,14+,15-,16+ |
| InChIKey | WIXCKTAPWUDARK-GEEKYZPCSA-N |
| XLogP | 3.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|