C19H30O3 — CID 134922444
(3S,3aR,4S,6aR)-3,5,5-trimethyl-4-(oxan-2-yloxy)-3-prop-2-enyl-3a,4,6,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 134922444) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (3S,3aR,4S,6aR)-3,5,5-trimethyl-4-(oxan-2-yloxy)-3-prop-2-enyl-3a,4,6,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | (3S,3aR,4S,6aR)-3,5,5-trimethyl-4-(oxan-2-yloxy)-3-prop-2-enyl-3a,4,6,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 134922444 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (3S,3aR,4S,6aR)-3,5,5-trimethyl-4-(oxan-2-yloxy)-3-prop-2-enyl-3a,4,6,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | C=CC[C@]1(C)C(=O)C[C@H]2CC(C)(C)[C@@H](OC3CCCCO3)[C@H]21 |
| InChI | InChI=1S/C19H30O3/c1-5-9-19(4)14(20)11-13-12-18(2,3)17(16(13)19)22-15-8-6-7-10-21-15/h5,13,15-17H,1,6-12H2,2-4H3/t13-,15?,16-,17-,19+/m0/s1 |
| InChIKey | WQIYQFXFSZRMDY-FDSSUXDGSA-N |
| XLogP | 4.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|