C17H27IO3 — CID 134864205
1-[(1R,2R)-2-ethenyl-5-[(1R)-2-iodo-1-(oxan-2-yloxy)ethyl]-1-methylcyclopentyl]ethanone (PubChem CID 134864205) has the molecular formula C17H27IO3 and a molecular weight of 406.30 g/mol. Its IUPAC name is 1-[(1R,2R)-2-ethenyl-5-[(1R)-2-iodo-1-(oxan-2-yloxy)ethyl]-1-methylcyclopentyl]ethanone.
| Compound Name | 1-[(1R,2R)-2-ethenyl-5-[(1R)-2-iodo-1-(oxan-2-yloxy)ethyl]-1-methylcyclopentyl]ethanone |
|---|---|
| PubChem CID | 134864205 |
| Molecular Formula | C17H27IO3 |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 1-[(1R,2R)-2-ethenyl-5-[(1R)-2-iodo-1-(oxan-2-yloxy)ethyl]-1-methylcyclopentyl]ethanone |
| SMILES | C=C[C@H]1CCC([C@H](CI)OC2CCCCO2)[C@]1(C)C(C)=O |
| InChI | InChI=1S/C17H27IO3/c1-4-13-8-9-14(17(13,3)12(2)19)15(11-18)21-16-7-5-6-10-20-16/h4,13-16H,1,5-11H2,2-3H3/t13-,14?,15-,16?,17+/m0/s1 |
| InChIKey | MMSPHUDWDRNGKT-NSPSMMDPSA-N |
| XLogP | 4.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|