C27H44O5 — CID 56613451
(3aS,4R,5R,6aR)-5-(oxan-2-yloxy)-4-[9-(oxan-2-yloxy)non-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one (PubChem CID 56613451) has the molecular formula C27H44O5 and a molecular weight of 448.64 g/mol. Its IUPAC name is (3aS,4R,5R,6aR)-5-(oxan-2-yloxy)-4-[9-(oxan-2-yloxy)non-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one.
| Compound Name | (3aS,4R,5R,6aR)-5-(oxan-2-yloxy)-4-[9-(oxan-2-yloxy)non-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 56613451 |
| Molecular Formula | C27H44O5 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | (3aS,4R,5R,6aR)-5-(oxan-2-yloxy)-4-[9-(oxan-2-yloxy)non-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-one |
| SMILES | O=C1C[C@H]2C[C@@H](OC3CCCCO3)[C@H](C=CCCCCCCCOC3CCCCO3)[C@H]2C1 |
| InChI | InChI=1S/C27H44O5/c28-22-18-21-19-25(32-27-14-8-11-17-31-27)23(24(21)20-22)12-6-4-2-1-3-5-9-15-29-26-13-7-10-16-30-26/h6,12,21,23-27H,1-5,7-11,13-20H2/t21-,23+,24-,25+,26?,27?/m0/s1 |
| InChIKey | WYFAOIGDTLZTNP-BNFADREQSA-N |
| XLogP | 5.95 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|