C17H25IO3 — CID 11761256
(1'S,2'S,3'aS,6'aR)-1'-(2-iodoprop-2-enyl)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde (PubChem CID 11761256) has the molecular formula C17H25IO3 and a molecular weight of 404.29 g/mol. Its IUPAC name is (1'S,2'S,3'aS,6'aR)-1'-(2-iodoprop-2-enyl)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde.
| Compound Name | (1'S,2'S,3'aS,6'aR)-1'-(2-iodoprop-2-enyl)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde |
|---|---|
| PubChem CID | 11761256 |
| Molecular Formula | C17H25IO3 |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | (1'S,2'S,3'aS,6'aR)-1'-(2-iodoprop-2-enyl)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde |
| SMILES | C=C(I)C[C@H]1[C@@H]2CC3(C[C@@H]2C[C@@H]1C=O)OCC(C)(C)CO3 |
| InChI | InChI=1S/C17H25IO3/c1-11(18)4-14-13(8-19)5-12-6-17(7-15(12)14)20-9-16(2,3)10-21-17/h8,12-15H,1,4-7,9-10H2,2-3H3/t12-,13+,14+,15+/m0/s1 |
| InChIKey | IYGGLXFYOIDJLP-GBJTYRQASA-N |
| XLogP | 3.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|