C18H27IO3 — CID 11048026
(1'S,2'S,3'aS,6'aR)-1'-(3-iodobut-3-enyl)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde (PubChem CID 11048026) has the molecular formula C18H27IO3 and a molecular weight of 418.32 g/mol. Its IUPAC name is (1'S,2'S,3'aS,6'aR)-1'-(3-iodobut-3-enyl)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde.
| Compound Name | (1'S,2'S,3'aS,6'aR)-1'-(3-iodobut-3-enyl)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde |
|---|---|
| PubChem CID | 11048026 |
| Molecular Formula | C18H27IO3 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | (1'S,2'S,3'aS,6'aR)-1'-(3-iodobut-3-enyl)-5,5-dimethylspiro[1,3-dioxane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-2'-carbaldehyde |
| SMILES | C=C(I)CC[C@H]1[C@@H]2CC3(C[C@@H]2C[C@@H]1C=O)OCC(C)(C)CO3 |
| InChI | InChI=1S/C18H27IO3/c1-12(19)4-5-15-14(9-20)6-13-7-18(8-16(13)15)21-10-17(2,3)11-22-18/h9,13-16H,1,4-8,10-11H2,2-3H3/t13-,14+,15+,16+/m0/s1 |
| InChIKey | XHEQXBVUKXVVFT-ZJIFWQFVSA-N |
| XLogP | 4.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|