C30H33NO4 — CID 102089503
5-acetyl-6-ethenyl-1-[(2S)-1-phenylmethoxybut-3-en-2-yl]-3-(3-phenylmethoxypropyl)pyridin-2-one (PubChem CID 102089503) has the molecular formula C30H33NO4 and a molecular weight of 471.60 g/mol. Its IUPAC name is 5-acetyl-6-ethenyl-1-[(2S)-1-phenylmethoxybut-3-en-2-yl]-3-(3-phenylmethoxypropyl)pyridin-2-one.
| Compound Name | 5-acetyl-6-ethenyl-1-[(2S)-1-phenylmethoxybut-3-en-2-yl]-3-(3-phenylmethoxypropyl)pyridin-2-one |
|---|---|
| PubChem CID | 102089503 |
| Molecular Formula | C30H33NO4 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 5-acetyl-6-ethenyl-1-[(2S)-1-phenylmethoxybut-3-en-2-yl]-3-(3-phenylmethoxypropyl)pyridin-2-one |
| SMILES | C=Cc1c(C(C)=O)cc(CCCOCc2ccccc2)c(=O)n1[C@@H](C=C)COCc1ccccc1 |
| InChI | InChI=1S/C30H33NO4/c1-4-27(22-35-21-25-15-10-7-11-16-25)31-29(5-2)28(23(3)32)19-26(30(31)33)17-12-18-34-20-24-13-8-6-9-14-24/h4-11,13-16,19,27H,1-2,12,17-18,20-22H2,3H3/t27-/m0/s1 |
| InChIKey | UJUMYNHJLYDXDS-MHZLTWQESA-N |
| XLogP | 5.79 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|