C22H39NOSi — CID 102089529
(3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methyl-9-phenylnon-1-en-3-amine (PubChem CID 102089529) has the molecular formula C22H39NOSi and a molecular weight of 361.65 g/mol. Its IUPAC name is (3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methyl-9-phenylnon-1-en-3-amine.
| Compound Name | (3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methyl-9-phenylnon-1-en-3-amine |
|---|---|
| PubChem CID | 102089529 |
| Molecular Formula | C22H39NOSi |
| Molecular Weight | 361.65 g/mol |
| Exact Mass | 361.28 |
| IUPAC Name | (3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-N-methyl-9-phenylnon-1-en-3-amine |
| SMILES | C=C[C@@H](C[C@H](CCCCc1ccccc1)O[Si](C)(C)C(C)(C)C)NC |
| InChI | InChI=1S/C22H39NOSi/c1-8-20(23-5)18-21(24-25(6,7)22(2,3)4)17-13-12-16-19-14-10-9-11-15-19/h8-11,14-15,20-21,23H,1,12-13,16-18H2,2-7H3/t20-,21-/m0/s1 |
| InChIKey | URIKPFSZWCAPIS-SFTDATJTSA-N |
| XLogP | 5.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|