C16H20O3S — CID 102090855
S-ethyl (2S,3R)-6-oxo-2-(2-phenylethyl)oxane-3-carbothioate (PubChem CID 102090855) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is S-ethyl (2S,3R)-6-oxo-2-(2-phenylethyl)oxane-3-carbothioate.
| Compound Name | S-ethyl (2S,3R)-6-oxo-2-(2-phenylethyl)oxane-3-carbothioate |
|---|---|
| PubChem CID | 102090855 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | S-ethyl (2S,3R)-6-oxo-2-(2-phenylethyl)oxane-3-carbothioate |
| SMILES | CCSC(=O)[C@@H]1CCC(=O)O[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C16H20O3S/c1-2-20-16(18)13-9-11-15(17)19-14(13)10-8-12-6-4-3-5-7-12/h3-7,13-14H,2,8-11H2,1H3/t13-,14+/m1/s1 |
| InChIKey | JJWSQRRMDZNVRY-KGLIPLIRSA-N |
| XLogP | 3.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|