C21H23BrO4 — CID 102094315
[4-[(2S)-2-methylbutoxy]phenyl] 3-bromo-4-prop-2-enoxybenzoate (PubChem CID 102094315) has the molecular formula C21H23BrO4 and a molecular weight of 419.32 g/mol. Its IUPAC name is [4-[(2S)-2-methylbutoxy]phenyl] 3-bromo-4-prop-2-enoxybenzoate.
| Compound Name | [4-[(2S)-2-methylbutoxy]phenyl] 3-bromo-4-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 102094315 |
| Molecular Formula | C21H23BrO4 |
| Molecular Weight | 419.32 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [4-[(2S)-2-methylbutoxy]phenyl] 3-bromo-4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)Oc2ccc(OC[C@@H](C)CC)cc2)cc1Br |
| InChI | InChI=1S/C21H23BrO4/c1-4-12-24-20-11-6-16(13-19(20)22)21(23)26-18-9-7-17(8-10-18)25-14-15(3)5-2/h4,6-11,13,15H,1,5,12,14H2,2-3H3/t15-/m0/s1 |
| InChIKey | ULUDCYJPVQAKBZ-HNNXBMFYSA-N |
| XLogP | 5.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.32 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|