C11H16OS — CID 102096401
(1S,3S,4R)-3-(2-methylprop-1-enyl)-2λ4-thiabicyclo[2.2.2]oct-5-ene 2-oxide (PubChem CID 102096401) has the molecular formula C11H16OS and a molecular weight of 196.31 g/mol. Its IUPAC name is (1S,3S,4R)-3-(2-methylprop-1-enyl)-2λ4-thiabicyclo[2.2.2]oct-5-ene 2-oxide.
| Compound Name | (1S,3S,4R)-3-(2-methylprop-1-enyl)-2λ4-thiabicyclo[2.2.2]oct-5-ene 2-oxide |
|---|---|
| PubChem CID | 102096401 |
| Molecular Formula | C11H16OS |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (1S,3S,4R)-3-(2-methylprop-1-enyl)-2λ4-thiabicyclo[2.2.2]oct-5-ene 2-oxide |
| SMILES | CC(C)=CC1[C@H]2C=C[C@H](CC2)S1=O |
| InChI | InChI=1S/C11H16OS/c1-8(2)7-11-9-3-5-10(6-4-9)13(11)12/h3,5,7,9-11H,4,6H2,1-2H3/t9-,10+,11?,13?/m0/s1 |
| InChIKey | BTHZIOKWINGKCA-KIENENRBSA-N |
| XLogP | 2.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|