C12H16F2OS — CID 11021185
(1S,4R)-2-(difluoromethyl)-3-propylsulfinylbicyclo[2.2.2]octa-2,5-diene (PubChem CID 11021185) has the molecular formula C12H16F2OS and a molecular weight of 246.32 g/mol. Its IUPAC name is (1S,4R)-2-(difluoromethyl)-3-propylsulfinylbicyclo[2.2.2]octa-2,5-diene.
| Compound Name | (1S,4R)-2-(difluoromethyl)-3-propylsulfinylbicyclo[2.2.2]octa-2,5-diene |
|---|---|
| PubChem CID | 11021185 |
| Molecular Formula | C12H16F2OS |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (1S,4R)-2-(difluoromethyl)-3-propylsulfinylbicyclo[2.2.2]octa-2,5-diene |
| SMILES | CCCS(=O)C1=C(C(F)F)[C@@H]2C=C[C@H]1CC2 |
| InChI | InChI=1S/C12H16F2OS/c1-2-7-16(15)11-9-5-3-8(4-6-9)10(11)12(13)14/h3,5,8-9,12H,2,4,6-7H2,1H3/t8-,9+,16?/m1/s1 |
| InChIKey | DIWCRDKYMQRNEF-PVLJOVISSA-N |
| XLogP | 3.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|