methyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate

C11H10BrFO2 — CID 102098459

IUPACmethyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate
SMILESCOC(=O)C1(F)CCc2c(Br)cccc21
InChIInChI=1S/C11H10BrFO2/c1-15-10(14)11(13)6-5-7-8(11)3-2-4-9(7)12/h2-4H,5-6H2,1H3
InChIKeyMTUVGYTUVGDYDF-UHFFFAOYSA-N
MW273.10 g/mol
LogP2.73
Rot. Bonds1

About methyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate

methyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate (PubChem CID 102098459) has the molecular formula C11H10BrFO2 and a molecular weight of 273.10 g/mol. Its IUPAC name is methyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate.

Molecular Properties

Compound Namemethyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate
PubChem CID102098459
Molecular FormulaC11H10BrFO2
Molecular Weight273.10 g/mol
Exact Mass271.98
IUPAC Namemethyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate
SMILESCOC(=O)C1(F)CCc2c(Br)cccc21
InChIInChI=1S/C11H10BrFO2/c1-15-10(14)11(13)6-5-7-8(11)3-2-4-9(7)12/h2-4H,5-6H2,1H3
InChIKeyMTUVGYTUVGDYDF-UHFFFAOYSA-N
XLogP2.73
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.10
LogP ≤ 52.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate?
The IUPAC name of methyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate (CID 102098459) is methyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate.
What is the SMILES notation for methyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate?
The canonical SMILES for methyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate is COC(=O)C1(F)CCc2c(Br)cccc21.
What is the InChIKey of methyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate?
The InChIKey is MTUVGYTUVGDYDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10BrFO2/c1-15-10(14)11(13)6-5-7-8(11)3-2-4-9(7)12/h2-4H,5-6H2,1H3.
What are the key properties of methyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate?
methyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate has a molecular weight of 273.10 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-1-fluoro-2,3-dihydroindene-1-carboxylate is sourced from PubChem (CID 102098459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).