About methyl 8-bromo-2-methyl-3,4-dihydro-1H-quinoline-2-carboxylate
methyl 8-bromo-2-methyl-3,4-dihydro-1H-quinoline-2-carboxylate (PubChem CID 117193490) has the molecular formula C12H14BrNO2
and a molecular weight of 284.15 g/mol. Its IUPAC name is methyl 8-bromo-2-methyl-3,4-dihydro-1H-quinoline-2-carboxylate.
Analyze methyl 8-bromo-2-methyl-3,4-dihydro-1H-quinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-bromo-2-methyl-3,4-dihydro-1H-quinoline-2-carboxylate?
The IUPAC name of methyl 8-bromo-2-methyl-3,4-dihydro-1H-quinoline-2-carboxylate (CID 117193490) is methyl 8-bromo-2-methyl-3,4-dihydro-1H-quinoline-2-carboxylate.
What is the SMILES notation for methyl 8-bromo-2-methyl-3,4-dihydro-1H-quinoline-2-carboxylate?
The canonical SMILES for methyl 8-bromo-2-methyl-3,4-dihydro-1H-quinoline-2-carboxylate is COC(=O)C1(C)CCc2cccc(Br)c2N1.
What is the InChIKey of methyl 8-bromo-2-methyl-3,4-dihydro-1H-quinoline-2-carboxylate?
The InChIKey is LWLBDHPMLIVBCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrNO2/c1-12(11(15)16-2)7-6-8-4-3-5-9(13)10(8)14-12/h3-5,14H,6-7H2,1-2H3.
What are the key properties of methyl 8-bromo-2-methyl-3,4-dihydro-1H-quinoline-2-carboxylate?
methyl 8-bromo-2-methyl-3,4-dihydro-1H-quinoline-2-carboxylate has a molecular weight of 284.15 g/mol, XLogP of 2.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-bromo-2-methyl-3,4-dihydro-1H-quinoline-2-carboxylate is sourced from PubChem (CID 117193490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).