C24H26F2N4O6S2 — CID 10209992
N-[(2S,3R,4R,5R)-5-benzamido-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]-2-(methanesulfonamido)-1,3-thiazole-4-carboxamide (PubChem CID 10209992) has the molecular formula C24H26F2N4O6S2 and a molecular weight of 568.62 g/mol. Its IUPAC name is N-[(2S,3R,4R,5R)-5-benzamido-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]-2-(methanesulfonamido)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(2S,3R,4R,5R)-5-benzamido-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]-2-(methanesulfonamido)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 10209992 |
| Molecular Formula | C24H26F2N4O6S2 |
| Molecular Weight | 568.62 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | N-[(2S,3R,4R,5R)-5-benzamido-1-(3,5-difluorophenyl)-3,4-dihydroxyhexan-2-yl]-2-(methanesulfonamido)-1,3-thiazole-4-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1)[C@@H](O)[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)c1csc(NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C24H26F2N4O6S2/c1-13(27-22(33)15-6-4-3-5-7-15)20(31)21(32)18(10-14-8-16(25)11-17(26)9-14)28-23(34)19-12-37-24(29-19)30-38(2,35)36/h3-9,11-13,18,20-21,31-32H,10H2,1-2H3,(H,27,33)(H,28,34)(H,29,30)/t13-,18+,20-,21-/m1/s1 |
| InChIKey | YLHLYVIZZROUCA-LGWKTVDISA-N |
| XLogP | 1.67 |
| TPSA | 157.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.62 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |