C22H30F2N4O6S2 — CID 10143904
N-[(2S,3R,4R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-6-(2-methylpropylamino)-6-oxohexan-2-yl]-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 10143904) has the molecular formula C22H30F2N4O6S2 and a molecular weight of 548.63 g/mol. Its IUPAC name is N-[(2S,3R,4R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-6-(2-methylpropylamino)-6-oxohexan-2-yl]-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(2S,3R,4R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-6-(2-methylpropylamino)-6-oxohexan-2-yl]-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 10143904 |
| Molecular Formula | C22H30F2N4O6S2 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | N-[(2S,3R,4R)-1-(3,5-difluorophenyl)-3,4-dihydroxy-6-(2-methylpropylamino)-6-oxohexan-2-yl]-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)CNC(=O)C[C@@H](O)[C@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)c1csc(N(C)S(C)(=O)=O)n1 |
| InChI | InChI=1S/C22H30F2N4O6S2/c1-12(2)10-25-19(30)9-18(29)20(31)16(7-13-5-14(23)8-15(24)6-13)26-21(32)17-11-35-22(27-17)28(3)36(4,33)34/h5-6,8,11-12,16,18,20,29,31H,7,9-10H2,1-4H3,(H,25,30)(H,26,32)/t16-,18+,20+/m0/s1 |
| InChIKey | DQLUXGWHMKYGRI-ILZDJORESA-N |
| XLogP | 1.04 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |