C21H27N5O6S2 — CID 10118313
N-[(2S,3R,4R,5R)-5-acetamido-6-cyano-3,4-dihydroxy-1-phenylhexan-2-yl]-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 10118313) has the molecular formula C21H27N5O6S2 and a molecular weight of 509.61 g/mol. Its IUPAC name is N-[(2S,3R,4R,5R)-5-acetamido-6-cyano-3,4-dihydroxy-1-phenylhexan-2-yl]-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(2S,3R,4R,5R)-5-acetamido-6-cyano-3,4-dihydroxy-1-phenylhexan-2-yl]-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 10118313 |
| Molecular Formula | C21H27N5O6S2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | N-[(2S,3R,4R,5R)-5-acetamido-6-cyano-3,4-dihydroxy-1-phenylhexan-2-yl]-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | CC(=O)N[C@H](CC#N)[C@@H](O)[C@H](O)[C@H](Cc1ccccc1)NC(=O)c1csc(N(C)S(C)(=O)=O)n1 |
| InChI | InChI=1S/C21H27N5O6S2/c1-13(27)23-15(9-10-22)18(28)19(29)16(11-14-7-5-4-6-8-14)24-20(30)17-12-33-21(25-17)26(2)34(3,31)32/h4-8,12,15-16,18-19,28-29H,9,11H2,1-3H3,(H,23,27)(H,24,30)/t15-,16+,18-,19-/m1/s1 |
| InChIKey | CMMSNKBEDFZAAV-UKBAYJJMSA-N |
| XLogP | 0.02 |
| TPSA | 172.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |