C28H34N4O6S2 — CID 147138282
N-[(2S,3R,4R,5R)-5-(benzylcarbamoyl)-3,4-dihydroxy-6-methyl-1-phenylhept-6-en-2-yl]-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 147138282) has the molecular formula C28H34N4O6S2 and a molecular weight of 586.74 g/mol. Its IUPAC name is N-[(2S,3R,4R,5R)-5-(benzylcarbamoyl)-3,4-dihydroxy-6-methyl-1-phenylhept-6-en-2-yl]-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(2S,3R,4R,5R)-5-(benzylcarbamoyl)-3,4-dihydroxy-6-methyl-1-phenylhept-6-en-2-yl]-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 147138282 |
| Molecular Formula | C28H34N4O6S2 |
| Molecular Weight | 586.74 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | N-[(2S,3R,4R,5R)-5-(benzylcarbamoyl)-3,4-dihydroxy-6-methyl-1-phenylhept-6-en-2-yl]-2-[methyl(methylsulfonyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | C=C(C)[C@@H](C(=O)NCc1ccccc1)[C@@H](O)[C@H](O)[C@H](Cc1ccccc1)NC(=O)c1csc(N(C)S(C)(=O)=O)n1 |
| InChI | InChI=1S/C28H34N4O6S2/c1-18(2)23(27(36)29-16-20-13-9-6-10-14-20)25(34)24(33)21(15-19-11-7-5-8-12-19)30-26(35)22-17-39-28(31-22)32(3)40(4,37)38/h5-14,17,21,23-25,33-34H,1,15-16H2,2-4H3,(H,29,36)(H,30,35)/t21-,23+,24+,25+/m0/s1 |
| InChIKey | BRPDUUGYFPCQPL-KVZCNWPJSA-N |
| XLogP | 2.11 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.74 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|