C26H30F2N4O6S2 — CID 142205104
2-[[(2S,3R,4R)-6-(benzylamino)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-methyl-6-oxohexan-2-yl]-ethylsulfonylamino]-1,3-thiazole-4-carboxamide (PubChem CID 142205104) has the molecular formula C26H30F2N4O6S2 and a molecular weight of 596.68 g/mol. Its IUPAC name is 2-[[(2S,3R,4R)-6-(benzylamino)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-methyl-6-oxohexan-2-yl]-ethylsulfonylamino]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[(2S,3R,4R)-6-(benzylamino)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-methyl-6-oxohexan-2-yl]-ethylsulfonylamino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 142205104 |
| Molecular Formula | C26H30F2N4O6S2 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | 2-[[(2S,3R,4R)-6-(benzylamino)-1-(3,5-difluorophenyl)-3,4-dihydroxy-5-methyl-6-oxohexan-2-yl]-ethylsulfonylamino]-1,3-thiazole-4-carboxamide |
| SMILES | CCS(=O)(=O)N(c1nc(C(N)=O)cs1)[C@@H](Cc1cc(F)cc(F)c1)[C@@H](O)[C@H](O)C(C)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H30F2N4O6S2/c1-3-40(37,38)32(26-31-20(14-39-26)24(29)35)21(11-17-9-18(27)12-19(28)10-17)23(34)22(33)15(2)25(36)30-13-16-7-5-4-6-8-16/h4-10,12,14-15,21-23,33-34H,3,11,13H2,1-2H3,(H2,29,35)(H,30,36)/t15?,21-,22+,23+/m0/s1 |
| InChIKey | VFXWBYJNCVWSOV-HCZSUOBMSA-N |
| XLogP | 1.96 |
| TPSA | 162.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |