C21H27N3O6S — CID 22394890
N-(3,4-dihydroxy-1-phenylnon-8-yn-2-yl)-2-[methyl(methylsulfonyl)amino]-1,3-oxazole-4-carboxamide (PubChem CID 22394890) has the molecular formula C21H27N3O6S and a molecular weight of 449.53 g/mol. Its IUPAC name is N-(3,4-dihydroxy-1-phenylnon-8-yn-2-yl)-2-[methyl(methylsulfonyl)amino]-1,3-oxazole-4-carboxamide.
| Compound Name | N-(3,4-dihydroxy-1-phenylnon-8-yn-2-yl)-2-[methyl(methylsulfonyl)amino]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 22394890 |
| Molecular Formula | C21H27N3O6S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-(3,4-dihydroxy-1-phenylnon-8-yn-2-yl)-2-[methyl(methylsulfonyl)amino]-1,3-oxazole-4-carboxamide |
| SMILES | C#CCCCC(O)C(O)C(Cc1ccccc1)NC(=O)c1coc(N(C)S(C)(=O)=O)n1 |
| InChI | InChI=1S/C21H27N3O6S/c1-4-5-7-12-18(25)19(26)16(13-15-10-8-6-9-11-15)22-20(27)17-14-30-21(23-17)24(2)31(3,28)29/h1,6,8-11,14,16,18-19,25-26H,5,7,12-13H2,2-3H3,(H,22,27) |
| InChIKey | SFEPQHQILIEWBE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 132.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|