C18H32N4O6S2 — CID 58635606
N-[(4S,5R,6R)-5,6-dihydroxy-2-methyl-8-(2-methylpropylamino)-8-oxooctan-4-yl]-2-(methanesulfonamido)-1,3-thiazole-4-carboxamide (PubChem CID 58635606) has the molecular formula C18H32N4O6S2 and a molecular weight of 464.61 g/mol. Its IUPAC name is N-[(4S,5R,6R)-5,6-dihydroxy-2-methyl-8-(2-methylpropylamino)-8-oxooctan-4-yl]-2-(methanesulfonamido)-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(4S,5R,6R)-5,6-dihydroxy-2-methyl-8-(2-methylpropylamino)-8-oxooctan-4-yl]-2-(methanesulfonamido)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 58635606 |
| Molecular Formula | C18H32N4O6S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N-[(4S,5R,6R)-5,6-dihydroxy-2-methyl-8-(2-methylpropylamino)-8-oxooctan-4-yl]-2-(methanesulfonamido)-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)CNC(=O)C[C@@H](O)[C@H](O)[C@H](CC(C)C)NC(=O)c1csc(NS(C)(=O)=O)n1 |
| InChI | InChI=1S/C18H32N4O6S2/c1-10(2)6-12(16(25)14(23)7-15(24)19-8-11(3)4)20-17(26)13-9-29-18(21-13)22-30(5,27)28/h9-12,14,16,23,25H,6-8H2,1-5H3,(H,19,24)(H,20,26)(H,21,22)/t12-,14+,16+/m0/s1 |
| InChIKey | XCKCMTHKTUOBCT-JGGQBBKZSA-N |
| XLogP | 0.54 |
| TPSA | 157.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |