C10H18FNOSi — CID 102100995
cis-(1R,2R)-2-fluoro-1-trimethylsilyloxycyclohexane-1-carbonitrile (PubChem CID 102100995) has the molecular formula C10H18FNOSi and a molecular weight of 215.34 g/mol. Its IUPAC name is cis-(1R,2R)-2-fluoro-1-trimethylsilyloxycyclohexane-1-carbonitrile.
| Compound Name | cis-(1R,2R)-2-fluoro-1-trimethylsilyloxycyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 102100995 |
| Molecular Formula | C10H18FNOSi |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | cis-(1R,2R)-2-fluoro-1-trimethylsilyloxycyclohexane-1-carbonitrile |
| SMILES | C[Si](C)(C)O[C@@]1(C#N)CCCC[C@H]1F |
| InChI | InChI=1S/C10H18FNOSi/c1-14(2,3)13-10(8-12)7-5-4-6-9(10)11/h9H,4-7H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | YTUPJWIJUYQGKZ-NXEZZACHSA-N |
| XLogP | 3.01 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|