C14H25NOSi — CID 101133005
(1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxybicyclo[2.2.1]heptane-2-carbonitrile (PubChem CID 101133005) has the molecular formula C14H25NOSi and a molecular weight of 251.45 g/mol. Its IUPAC name is (1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxybicyclo[2.2.1]heptane-2-carbonitrile.
| Compound Name | (1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxybicyclo[2.2.1]heptane-2-carbonitrile |
|---|---|
| PubChem CID | 101133005 |
| Molecular Formula | C14H25NOSi |
| Molecular Weight | 251.45 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxybicyclo[2.2.1]heptane-2-carbonitrile |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@](C#N)(O[Si](C)(C)C)C2 |
| InChI | InChI=1S/C14H25NOSi/c1-12(2)11-7-8-13(12,3)14(9-11,10-15)16-17(4,5)6/h11H,7-9H2,1-6H3/t11-,13-,14+/m1/s1 |
| InChIKey | ZYXLSWOSEYNVLC-BNOWGMLFSA-N |
| XLogP | 3.95 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|