C15H22O2 — CID 11630033
(1R,2R,3'R,4R)-1,7,7-trimethyl-3'-(prop-2-ynoxymethyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane] (PubChem CID 11630033) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1R,2R,3'R,4R)-1,7,7-trimethyl-3'-(prop-2-ynoxymethyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane].
| Compound Name | (1R,2R,3'R,4R)-1,7,7-trimethyl-3'-(prop-2-ynoxymethyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane] |
|---|---|
| PubChem CID | 11630033 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1R,2R,3'R,4R)-1,7,7-trimethyl-3'-(prop-2-ynoxymethyl)spiro[bicyclo[2.2.1]heptane-2,2'-oxirane] |
| SMILES | C#CCOC[C@H]1O[C@@]12C[C@H]1CC[C@]2(C)C1(C)C |
| InChI | InChI=1S/C15H22O2/c1-5-8-16-10-12-15(17-12)9-11-6-7-14(15,4)13(11,2)3/h1,11-12H,6-10H2,2-4H3/t11-,12-,14-,15+/m1/s1 |
| InChIKey | OVDHZMVASMQYLY-GBOPCIDUSA-N |
| XLogP | 2.62 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|