C15H24O2 — CID 11536010
[(1R,2R,4R)-1,7,7-trimethyl-4'-methylidenespiro[bicyclo[2.2.1]heptane-2,2'-oxolane]-3'-yl]methanol (PubChem CID 11536010) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is [(1R,2R,4R)-1,7,7-trimethyl-4'-methylidenespiro[bicyclo[2.2.1]heptane-2,2'-oxolane]-3'-yl]methanol.
| Compound Name | [(1R,2R,4R)-1,7,7-trimethyl-4'-methylidenespiro[bicyclo[2.2.1]heptane-2,2'-oxolane]-3'-yl]methanol |
|---|---|
| PubChem CID | 11536010 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | [(1R,2R,4R)-1,7,7-trimethyl-4'-methylidenespiro[bicyclo[2.2.1]heptane-2,2'-oxolane]-3'-yl]methanol |
| SMILES | C=C1CO[C@]2(C[C@H]3CC[C@]2(C)C3(C)C)C1CO |
| InChI | InChI=1S/C15H24O2/c1-10-9-17-15(12(10)8-16)7-11-5-6-14(15,4)13(11,2)3/h11-12,16H,1,5-9H2,2-4H3/t11-,12?,14-,15-/m1/s1 |
| InChIKey | GEWPDXSOWJZTQN-FMCMVYLNSA-N |
| XLogP | 2.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|