C44H54Si2 — CID 102101091
[4-[4-[4,5-dibutyl-2-[4-(4-trimethylsilylphenyl)phenyl]phenyl]phenyl]phenyl]-trimethylsilane (PubChem CID 102101091) has the molecular formula C44H54Si2 and a molecular weight of 639.09 g/mol. Its IUPAC name is [4-[4-[4,5-dibutyl-2-[4-(4-trimethylsilylphenyl)phenyl]phenyl]phenyl]phenyl]-trimethylsilane.
| Compound Name | [4-[4-[4,5-dibutyl-2-[4-(4-trimethylsilylphenyl)phenyl]phenyl]phenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 102101091 |
| Molecular Formula | C44H54Si2 |
| Molecular Weight | 639.09 g/mol |
| Exact Mass | 638.38 |
| IUPAC Name | [4-[4-[4,5-dibutyl-2-[4-(4-trimethylsilylphenyl)phenyl]phenyl]phenyl]phenyl]-trimethylsilane |
| SMILES | CCCCc1cc(-c2ccc(-c3ccc([Si](C)(C)C)cc3)cc2)c(-c2ccc(-c3ccc([Si](C)(C)C)cc3)cc2)cc1CCCC |
| InChI | InChI=1S/C44H54Si2/c1-9-11-13-39-31-43(37-19-15-33(16-20-37)35-23-27-41(28-24-35)45(3,4)5)44(32-40(39)14-12-10-2)38-21-17-34(18-22-38)36-25-29-42(30-26-36)46(6,7)8/h15-32H,9-14H2,1-8H3 |
| InChIKey | XEYKTDJMRYKPFY-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.09 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|