C51H56BrClSi — CID 11803508
[4-[3-[4-[3-[4-(3-bromophenyl)phenyl]phenyl]-2,5-dihexylphenyl]-5-chlorophenyl]phenyl]-trimethylsilane (PubChem CID 11803508) has the molecular formula C51H56BrClSi and a molecular weight of 812.45 g/mol. Its IUPAC name is [4-[3-[4-[3-[4-(3-bromophenyl)phenyl]phenyl]-2,5-dihexylphenyl]-5-chlorophenyl]phenyl]-trimethylsilane.
| Compound Name | [4-[3-[4-[3-[4-(3-bromophenyl)phenyl]phenyl]-2,5-dihexylphenyl]-5-chlorophenyl]phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 11803508 |
| Molecular Formula | C51H56BrClSi |
| Molecular Weight | 812.45 g/mol |
| Exact Mass | 810.30 |
| IUPAC Name | [4-[3-[4-[3-[4-(3-bromophenyl)phenyl]phenyl]-2,5-dihexylphenyl]-5-chlorophenyl]phenyl]-trimethylsilane |
| SMILES | CCCCCCc1cc(-c2cc(Cl)cc(-c3ccc([Si](C)(C)C)cc3)c2)c(CCCCCC)cc1-c1cccc(-c2ccc(-c3cccc(Br)c3)cc2)c1 |
| InChI | InChI=1S/C51H56BrClSi/c1-6-8-10-12-16-43-36-51(46-31-45(33-48(53)34-46)39-26-28-49(29-27-39)54(3,4)5)44(17-13-11-9-7-2)35-50(43)42-20-14-18-40(30-42)37-22-24-38(25-23-37)41-19-15-21-47(52)32-41/h14-15,18-36H,6-13,16-17H2,1-5H3 |
| InChIKey | FHIILBRCKAQIQJ-UHFFFAOYSA-N |
| XLogP | 16.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.45 |
| LogP ≤ 5 | 16.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|