C27H24F2O2 — CID 102101578
[1-(2-benzylphenyl)-3-(2,3-difluorophenyl)prop-2-ynyl] 2,2-dimethylpropanoate (PubChem CID 102101578) has the molecular formula C27H24F2O2 and a molecular weight of 418.48 g/mol. Its IUPAC name is [1-(2-benzylphenyl)-3-(2,3-difluorophenyl)prop-2-ynyl] 2,2-dimethylpropanoate.
| Compound Name | [1-(2-benzylphenyl)-3-(2,3-difluorophenyl)prop-2-ynyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102101578 |
| Molecular Formula | C27H24F2O2 |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [1-(2-benzylphenyl)-3-(2,3-difluorophenyl)prop-2-ynyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(C#Cc1cccc(F)c1F)c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C27H24F2O2/c1-27(2,3)26(30)31-24(17-16-20-13-9-15-23(28)25(20)29)22-14-8-7-12-21(22)18-19-10-5-4-6-11-19/h4-15,24H,18H2,1-3H3 |
| InChIKey | RVTOKHPRRRAKGC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|