C19H19ClO3 — CID 102105033
(1R)-1-[(2S)-4-chloro-2-(4-methoxyphenyl)-2H-chromen-3-yl]propan-1-ol (PubChem CID 102105033) has the molecular formula C19H19ClO3 and a molecular weight of 330.81 g/mol. Its IUPAC name is (1R)-1-[(2S)-4-chloro-2-(4-methoxyphenyl)-2H-chromen-3-yl]propan-1-ol.
| Compound Name | (1R)-1-[(2S)-4-chloro-2-(4-methoxyphenyl)-2H-chromen-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 102105033 |
| Molecular Formula | C19H19ClO3 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (1R)-1-[(2S)-4-chloro-2-(4-methoxyphenyl)-2H-chromen-3-yl]propan-1-ol |
| SMILES | CC[C@@H](O)C1=C(Cl)c2ccccc2O[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H19ClO3/c1-3-15(21)17-18(20)14-6-4-5-7-16(14)23-19(17)12-8-10-13(22-2)11-9-12/h4-11,15,19,21H,3H2,1-2H3/t15-,19+/m1/s1 |
| InChIKey | ONKIVSURWCJDTO-BEFAXECRSA-N |
| XLogP | 4.55 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |