About (3E)-3-hexylidene-2-(4-methoxyphenyl)-1,4-benzodioxine
(3E)-3-hexylidene-2-(4-methoxyphenyl)-1,4-benzodioxine (PubChem CID 101222170) has the molecular formula C21H24O3
and a molecular weight of 324.42 g/mol. Its IUPAC name is (3E)-3-hexylidene-2-(4-methoxyphenyl)-1,4-benzodioxine.
Molecular Properties
| Compound Name | (3E)-3-hexylidene-2-(4-methoxyphenyl)-1,4-benzodioxine |
| PubChem CID | 101222170 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (3E)-3-hexylidene-2-(4-methoxyphenyl)-1,4-benzodioxine |
| SMILES | CCCCC/C=C1/Oc2ccccc2OC1c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H24O3/c1-3-4-5-6-11-20-21(16-12-14-17(22-2)15-13-16)24-19-10-8-7-9-18(19)23-20/h7-15,21H,3-6H2,1-2H3/b20-11+ |
| InChIKey | MAKINWYOMGULRR-RGVLZGJSSA-N |
| XLogP | 5.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3E)-3-hexylidene-2-(4-methoxyphenyl)-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-3-hexylidene-2-(4-methoxyphenyl)-1,4-benzodioxine?
The IUPAC name of (3E)-3-hexylidene-2-(4-methoxyphenyl)-1,4-benzodioxine (CID 101222170) is (3E)-3-hexylidene-2-(4-methoxyphenyl)-1,4-benzodioxine.
What is the SMILES notation for (3E)-3-hexylidene-2-(4-methoxyphenyl)-1,4-benzodioxine?
The canonical SMILES for (3E)-3-hexylidene-2-(4-methoxyphenyl)-1,4-benzodioxine is CCCCC/C=C1/Oc2ccccc2OC1c1ccc(OC)cc1.
What is the InChIKey of (3E)-3-hexylidene-2-(4-methoxyphenyl)-1,4-benzodioxine?
The InChIKey is MAKINWYOMGULRR-RGVLZGJSSA-N. The full InChI is InChI=1S/C21H24O3/c1-3-4-5-6-11-20-21(16-12-14-17(22-2)15-13-16)24-19-10-8-7-9-18(19)23-20/h7-15,21H,3-6H2,1-2H3/b20-11+.
What are the key properties of (3E)-3-hexylidene-2-(4-methoxyphenyl)-1,4-benzodioxine?
(3E)-3-hexylidene-2-(4-methoxyphenyl)-1,4-benzodioxine has a molecular weight of 324.42 g/mol, XLogP of 5.67, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-3-hexylidene-2-(4-methoxyphenyl)-1,4-benzodioxine is sourced from PubChem (CID 101222170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).