C25H23BrCl2N4O2S — CID 10210663
N-[3-bromo-5-[[(3,4-dichlorophenyl)carbamothioylamino]carbamoyl]phenyl]-5-phenylpentanamide (PubChem CID 10210663) has the molecular formula C25H23BrCl2N4O2S and a molecular weight of 594.36 g/mol. Its IUPAC name is N-[3-bromo-5-[[(3,4-dichlorophenyl)carbamothioylamino]carbamoyl]phenyl]-5-phenylpentanamide.
| Compound Name | N-[3-bromo-5-[[(3,4-dichlorophenyl)carbamothioylamino]carbamoyl]phenyl]-5-phenylpentanamide |
|---|---|
| PubChem CID | 10210663 |
| Molecular Formula | C25H23BrCl2N4O2S |
| Molecular Weight | 594.36 g/mol |
| Exact Mass | 592.01 |
| IUPAC Name | N-[3-bromo-5-[[(3,4-dichlorophenyl)carbamothioylamino]carbamoyl]phenyl]-5-phenylpentanamide |
| SMILES | O=C(CCCCc1ccccc1)Nc1cc(Br)cc(C(=O)NNC(=S)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C25H23BrCl2N4O2S/c26-18-12-17(24(34)31-32-25(35)30-19-10-11-21(27)22(28)15-19)13-20(14-18)29-23(33)9-5-4-8-16-6-2-1-3-7-16/h1-3,6-7,10-15H,4-5,8-9H2,(H,29,33)(H,31,34)(H2,30,32,35) |
| InChIKey | MPBDNYFBFRZQQP-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.36 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|