C30H33ClO9S — CID 10210924
(7S,9S)-9-acetyl-7-[3-(2-chloroethylsulfanyl)-4-hydroxy-5-methylcyclohexyl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 10210924) has the molecular formula C30H33ClO9S and a molecular weight of 605.11 g/mol. Its IUPAC name is (7S,9S)-9-acetyl-7-[3-(2-chloroethylsulfanyl)-4-hydroxy-5-methylcyclohexyl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9S)-9-acetyl-7-[3-(2-chloroethylsulfanyl)-4-hydroxy-5-methylcyclohexyl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 10210924 |
| Molecular Formula | C30H33ClO9S |
| Molecular Weight | 605.11 g/mol |
| Exact Mass | 604.15 |
| IUPAC Name | (7S,9S)-9-acetyl-7-[3-(2-chloroethylsulfanyl)-4-hydroxy-5-methylcyclohexyl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3OC1CC(C)C(O)C(SCCCl)C1 |
| InChI | InChI=1S/C30H33ClO9S/c1-13-9-15(10-20(25(13)33)41-8-7-31)40-19-12-30(38,14(2)32)11-17-22(19)29(37)24-23(27(17)35)26(34)16-5-4-6-18(39-3)21(16)28(24)36/h4-6,13,15,19-20,25,33,35,37-38H,7-12H2,1-3H3/t13?,15?,19-,20?,25?,30-/m0/s1 |
| InChIKey | KAMTYBTZJZACRU-FEHPKEHGSA-N |
| XLogP | 3.71 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.11 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|