C35H37ClFNO9 — CID 91123696
(7S,9S)-9-acetyl-7-[3-[(4-fluorophenyl)methylamino]-4-hydroxy-5-methylcyclohexyl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione;hydrochloride (PubChem CID 91123696) has the molecular formula C35H37ClFNO9 and a molecular weight of 670.13 g/mol. Its IUPAC name is (7S,9S)-9-acetyl-7-[3-[(4-fluorophenyl)methylamino]-4-hydroxy-5-methylcyclohexyl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione;hydrochloride.
| Compound Name | (7S,9S)-9-acetyl-7-[3-[(4-fluorophenyl)methylamino]-4-hydroxy-5-methylcyclohexyl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione;hydrochloride |
|---|---|
| PubChem CID | 91123696 |
| Molecular Formula | C35H37ClFNO9 |
| Molecular Weight | 670.13 g/mol |
| Exact Mass | 669.21 |
| IUPAC Name | (7S,9S)-9-acetyl-7-[3-[(4-fluorophenyl)methylamino]-4-hydroxy-5-methylcyclohexyl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione;hydrochloride |
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)C[C@@](O)(C(C)=O)C[C@@H]3OC1CC(C)C(O)C(NCc2ccc(F)cc2)C1.Cl |
| InChI | InChI=1S/C35H36FNO9.ClH/c1-16-11-20(12-23(30(16)39)37-15-18-7-9-19(36)10-8-18)46-25-14-35(44,17(2)38)13-22-27(25)34(43)29-28(32(22)41)31(40)21-5-4-6-24(45-3)26(21)33(29)42;/h4-10,16,20,23,25,30,37,39,41,43-44H,11-15H2,1-3H3;1H/t16?,20?,23?,25-,30?,35-;/m0./s1 |
| InChIKey | AWIVZUPDXSSFMH-GPMYZQBMSA-N |
| XLogP | 4.08 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.13 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|