C26H20N4O3 — CID 102111496
(2R,3S,5R)-5-[6-(2-anthracen-9-ylethynyl)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 102111496) has the molecular formula C26H20N4O3 and a molecular weight of 436.47 g/mol. Its IUPAC name is (2R,3S,5R)-5-[6-(2-anthracen-9-ylethynyl)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-[6-(2-anthracen-9-ylethynyl)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 102111496 |
| Molecular Formula | C26H20N4O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (2R,3S,5R)-5-[6-(2-anthracen-9-ylethynyl)purin-9-yl]-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(C#Cc4c5ccccc5cc5ccccc45)ncnc32)C[C@@H]1O |
| InChI | InChI=1S/C26H20N4O3/c31-13-23-22(32)12-24(33-23)30-15-29-25-21(27-14-28-26(25)30)10-9-20-18-7-3-1-5-16(18)11-17-6-2-4-8-19(17)20/h1-8,11,14-15,22-24,31-32H,12-13H2/t22-,23+,24+/m0/s1 |
| InChIKey | CYWRKHZJKLDECK-RBZQAINGSA-N |
| XLogP | 3.17 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|