C21H18N2O3 — CID 102111648
(3R,5'R)-2-benzyl-5'-hydroxy-1'-prop-2-ynylspiro[isoindole-3,4'-pyrrolidine]-1,2'-dione (PubChem CID 102111648) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is (3R,5'R)-2-benzyl-5'-hydroxy-1'-prop-2-ynylspiro[isoindole-3,4'-pyrrolidine]-1,2'-dione.
| Compound Name | (3R,5'R)-2-benzyl-5'-hydroxy-1'-prop-2-ynylspiro[isoindole-3,4'-pyrrolidine]-1,2'-dione |
|---|---|
| PubChem CID | 102111648 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (3R,5'R)-2-benzyl-5'-hydroxy-1'-prop-2-ynylspiro[isoindole-3,4'-pyrrolidine]-1,2'-dione |
| SMILES | C#CCN1C(=O)C[C@@]2(c3ccccc3C(=O)N2Cc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C21H18N2O3/c1-2-12-22-18(24)13-21(20(22)26)17-11-7-6-10-16(17)19(25)23(21)14-15-8-4-3-5-9-15/h1,3-11,20,26H,12-14H2/t20-,21-/m1/s1 |
| InChIKey | WPBNQPXHTVSSGM-NHCUHLMSSA-N |
| XLogP | 1.72 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|