C24H22N2O2 — CID 102111650
(3R,5'R)-1'-benzyl-5'-prop-2-enyl-2-prop-2-ynylspiro[isoindole-3,4'-pyrrolidine]-1,2'-dione (PubChem CID 102111650) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is (3R,5'R)-1'-benzyl-5'-prop-2-enyl-2-prop-2-ynylspiro[isoindole-3,4'-pyrrolidine]-1,2'-dione.
| Compound Name | (3R,5'R)-1'-benzyl-5'-prop-2-enyl-2-prop-2-ynylspiro[isoindole-3,4'-pyrrolidine]-1,2'-dione |
|---|---|
| PubChem CID | 102111650 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | (3R,5'R)-1'-benzyl-5'-prop-2-enyl-2-prop-2-ynylspiro[isoindole-3,4'-pyrrolidine]-1,2'-dione |
| SMILES | C#CCN1C(=O)c2ccccc2[C@@]12CC(=O)N(Cc1ccccc1)[C@@H]2CC=C |
| InChI | InChI=1S/C24H22N2O2/c1-3-10-21-24(16-22(27)25(21)17-18-11-6-5-7-12-18)20-14-9-8-13-19(20)23(28)26(24)15-4-2/h2-3,5-9,11-14,21H,1,10,15-17H2/t21-,24-/m1/s1 |
| InChIKey | BAPNXKWRAWCOGC-ZJSXRUAMSA-N |
| XLogP | 3.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|