C19H34O2Si2 — CID 102112116
(1S,2S,3R,4S,5R,6R)-1-ethyl-3,4-bis(trimethylsilylmethyl)-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one (PubChem CID 102112116) has the molecular formula C19H34O2Si2 and a molecular weight of 350.65 g/mol. Its IUPAC name is (1S,2S,3R,4S,5R,6R)-1-ethyl-3,4-bis(trimethylsilylmethyl)-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one.
| Compound Name | (1S,2S,3R,4S,5R,6R)-1-ethyl-3,4-bis(trimethylsilylmethyl)-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one |
|---|---|
| PubChem CID | 102112116 |
| Molecular Formula | C19H34O2Si2 |
| Molecular Weight | 350.65 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1S,2S,3R,4S,5R,6R)-1-ethyl-3,4-bis(trimethylsilylmethyl)-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one |
| SMILES | CC[C@@]12C=C[C@@H](O1)[C@@H]1C(=O)[C@H]2[C@@H](C[Si](C)(C)C)[C@H]1C[Si](C)(C)C |
| InChI | InChI=1S/C19H34O2Si2/c1-8-19-10-9-15(21-19)16-13(11-22(2,3)4)14(12-23(5,6)7)17(19)18(16)20/h9-10,13-17H,8,11-12H2,1-7H3/t13-,14+,15-,16-,17-,19+/m1/s1 |
| InChIKey | DTCWGGQOBTVDAW-QCQTWIRCSA-N |
| XLogP | 4.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.65 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|