C27H52O3Si3 — CID 102112119
(1R,2R,3S,4R,5S,6S)-1-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-3,4-bis(trimethylsilylmethyl)-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one (PubChem CID 102112119) has the molecular formula C27H52O3Si3 and a molecular weight of 508.97 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S,6S)-1-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-3,4-bis(trimethylsilylmethyl)-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one.
| Compound Name | (1R,2R,3S,4R,5S,6S)-1-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-3,4-bis(trimethylsilylmethyl)-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one |
|---|---|
| PubChem CID | 102112119 |
| Molecular Formula | C27H52O3Si3 |
| Molecular Weight | 508.97 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | (1R,2R,3S,4R,5S,6S)-1-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-3,4-bis(trimethylsilylmethyl)-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC[C@]12C=C[C@H](O1)[C@H]1C(=O)[C@@H]2[C@H](C[Si](C)(C)C)[C@@H]1C[Si](C)(C)C |
| InChI | InChI=1S/C27H52O3Si3/c1-26(2,3)33(10,11)29-17-13-12-15-27-16-14-22(30-27)23-20(18-31(4,5)6)21(19-32(7,8)9)24(27)25(23)28/h14,16,20-24H,12-13,15,17-19H2,1-11H3/t20-,21+,22-,23-,24-,27+/m0/s1 |
| InChIKey | CXGHSKPKKLEDMS-ZHQALRMLSA-N |
| XLogP | 7.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.97 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|