C24H36O2Si2 — CID 102112118
(1S,2S,3R,4S,5R,6R)-1-benzyl-3,4-bis(trimethylsilylmethyl)-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one (PubChem CID 102112118) has the molecular formula C24H36O2Si2 and a molecular weight of 412.72 g/mol. Its IUPAC name is (1S,2S,3R,4S,5R,6R)-1-benzyl-3,4-bis(trimethylsilylmethyl)-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one.
| Compound Name | (1S,2S,3R,4S,5R,6R)-1-benzyl-3,4-bis(trimethylsilylmethyl)-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one |
|---|---|
| PubChem CID | 102112118 |
| Molecular Formula | C24H36O2Si2 |
| Molecular Weight | 412.72 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | (1S,2S,3R,4S,5R,6R)-1-benzyl-3,4-bis(trimethylsilylmethyl)-9-oxatricyclo[4.2.1.12,5]dec-7-en-10-one |
| SMILES | C[Si](C)(C)C[C@@H]1[C@H](C[Si](C)(C)C)[C@@H]2C(=O)[C@H]1[C@H]1C=C[C@]2(Cc2ccccc2)O1 |
| InChI | InChI=1S/C24H36O2Si2/c1-27(2,3)15-18-19(16-28(4,5)6)22-23(25)21(18)20-12-13-24(22,26-20)14-17-10-8-7-9-11-17/h7-13,18-22H,14-16H2,1-6H3/t18-,19+,20-,21-,22-,24-/m1/s1 |
| InChIKey | YIGMAUGPOZRKKB-RQOGSKLQSA-N |
| XLogP | 5.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.72 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|