C15H14Br2O3 — CID 134882934
(1S,5S)-2,4-dibromo-1-(phenylmethoxymethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 134882934) has the molecular formula C15H14Br2O3 and a molecular weight of 402.08 g/mol. Its IUPAC name is (1S,5S)-2,4-dibromo-1-(phenylmethoxymethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,5S)-2,4-dibromo-1-(phenylmethoxymethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 134882934 |
| Molecular Formula | C15H14Br2O3 |
| Molecular Weight | 402.08 g/mol |
| Exact Mass | 399.93 |
| IUPAC Name | (1S,5S)-2,4-dibromo-1-(phenylmethoxymethyl)-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | O=C1C(Br)[C@@H]2C=C[C@@](COCc3ccccc3)(O2)C1Br |
| InChI | InChI=1S/C15H14Br2O3/c16-12-11-6-7-15(20-11,14(17)13(12)18)9-19-8-10-4-2-1-3-5-10/h1-7,11-12,14H,8-9H2/t11-,12?,14?,15-/m0/s1 |
| InChIKey | ZBRPVNUDDPDRRI-WZKVNAIUSA-N |
| XLogP | 3.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.08 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|