C32H16F10 — CID 102112734
1,6,7,10-tetramethyl-8,9-bis(2,3,4,5,6-pentafluorophenyl)fluoranthene (PubChem CID 102112734) has the molecular formula C32H16F10 and a molecular weight of 590.46 g/mol. Its IUPAC name is 1,6,7,10-tetramethyl-8,9-bis(2,3,4,5,6-pentafluorophenyl)fluoranthene.
| Compound Name | 1,6,7,10-tetramethyl-8,9-bis(2,3,4,5,6-pentafluorophenyl)fluoranthene |
|---|---|
| PubChem CID | 102112734 |
| Molecular Formula | C32H16F10 |
| Molecular Weight | 590.46 g/mol |
| Exact Mass | 590.11 |
| IUPAC Name | 1,6,7,10-tetramethyl-8,9-bis(2,3,4,5,6-pentafluorophenyl)fluoranthene |
| SMILES | Cc1ccc2ccc(C)c3c2c1-c1c(C)c(-c2c(F)c(F)c(F)c(F)c2F)c(-c2c(F)c(F)c(F)c(F)c2F)c(C)c1-3 |
| InChI | InChI=1S/C32H16F10/c1-9-5-7-13-8-6-10(2)15-17-12(4)19(22-25(35)29(39)32(42)30(40)26(22)36)18(11(3)16(17)14(9)20(13)15)21-23(33)27(37)31(41)28(38)24(21)34/h5-8H,1-4H3 |
| InChIKey | WENQJKRPRPLCMW-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.46 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|