C29H27FO6S — CID 102112900
1-[2-[(E)-2-(4-fluorophenyl)ethenyl]-3,4,5,6-tetramethoxyphenyl]sulfinyl-2-methoxynaphthalene (PubChem CID 102112900) has the molecular formula C29H27FO6S and a molecular weight of 522.59 g/mol. Its IUPAC name is 1-[2-[(E)-2-(4-fluorophenyl)ethenyl]-3,4,5,6-tetramethoxyphenyl]sulfinyl-2-methoxynaphthalene.
| Compound Name | 1-[2-[(E)-2-(4-fluorophenyl)ethenyl]-3,4,5,6-tetramethoxyphenyl]sulfinyl-2-methoxynaphthalene |
|---|---|
| PubChem CID | 102112900 |
| Molecular Formula | C29H27FO6S |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 522.15 |
| IUPAC Name | 1-[2-[(E)-2-(4-fluorophenyl)ethenyl]-3,4,5,6-tetramethoxyphenyl]sulfinyl-2-methoxynaphthalene |
| SMILES | COc1ccc2ccccc2c1S(=O)c1c(/C=C/c2ccc(F)cc2)c(OC)c(OC)c(OC)c1OC |
| InChI | InChI=1S/C29H27FO6S/c1-32-23-17-13-19-8-6-7-9-21(19)28(23)37(31)29-22(16-12-18-10-14-20(30)15-11-18)24(33-2)25(34-3)26(35-4)27(29)36-5/h6-17H,1-5H3/b16-12+ |
| InChIKey | AJCWSEZARNRNAJ-FOWTUZBSSA-N |
| XLogP | 6.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|