C28H25FO5S — CID 57380904
1-[(R)-[2-[(E)-2-(4-fluorophenyl)ethenyl]-3,4,5-trimethoxyphenyl]sulfinyl]-2-methoxynaphthalene (PubChem CID 57380904) has the molecular formula C28H25FO5S and a molecular weight of 492.57 g/mol. Its IUPAC name is 1-[(R)-[2-[(E)-2-(4-fluorophenyl)ethenyl]-3,4,5-trimethoxyphenyl]sulfinyl]-2-methoxynaphthalene.
| Compound Name | 1-[(R)-[2-[(E)-2-(4-fluorophenyl)ethenyl]-3,4,5-trimethoxyphenyl]sulfinyl]-2-methoxynaphthalene |
|---|---|
| PubChem CID | 57380904 |
| Molecular Formula | C28H25FO5S |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 1-[(R)-[2-[(E)-2-(4-fluorophenyl)ethenyl]-3,4,5-trimethoxyphenyl]sulfinyl]-2-methoxynaphthalene |
| SMILES | COc1cc([S@@](=O)c2c(OC)ccc3ccccc23)c(/C=C/c2ccc(F)cc2)c(OC)c1OC |
| InChI | InChI=1S/C28H25FO5S/c1-31-23-16-12-19-7-5-6-8-21(19)28(23)35(30)25-17-24(32-2)27(34-4)26(33-3)22(25)15-11-18-9-13-20(29)14-10-18/h5-17H,1-4H3/b15-11+/t35-/m1/s1 |
| InChIKey | JNYDASCDINKTEE-KKQDOYGZSA-N |
| XLogP | 6.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|