C19H27NO4S — CID 102114938
methyl (2S)-2-[2-cyclohexylideneethyl-(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 102114938) has the molecular formula C19H27NO4S and a molecular weight of 365.50 g/mol. Its IUPAC name is methyl (2S)-2-[2-cyclohexylideneethyl-(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl (2S)-2-[2-cyclohexylideneethyl-(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 102114938 |
| Molecular Formula | C19H27NO4S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | methyl (2S)-2-[2-cyclohexylideneethyl-(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@H](C)N(CC=C1CCCCC1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H27NO4S/c1-15-9-11-18(12-10-15)25(22,23)20(16(2)19(21)24-3)14-13-17-7-5-4-6-8-17/h9-13,16H,4-8,14H2,1-3H3/t16-/m0/s1 |
| InChIKey | DFFKUAORKDRMFJ-INIZCTEOSA-N |
| XLogP | 3.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|