C38H41F3N4O3 — CID 10211742
[2,6-dimethyl-4-(1-oxidopyridin-1-ium-4-yl)phenyl]-[4-methyl-4-[4-(N-[4-(trifluoromethoxy)phenyl]anilino)piperidin-1-yl]piperidin-1-yl]methanone (PubChem CID 10211742) has the molecular formula C38H41F3N4O3 and a molecular weight of 658.77 g/mol. Its IUPAC name is [2,6-dimethyl-4-(1-oxidopyridin-1-ium-4-yl)phenyl]-[4-methyl-4-[4-(N-[4-(trifluoromethoxy)phenyl]anilino)piperidin-1-yl]piperidin-1-yl]methanone.
| Compound Name | [2,6-dimethyl-4-(1-oxidopyridin-1-ium-4-yl)phenyl]-[4-methyl-4-[4-(N-[4-(trifluoromethoxy)phenyl]anilino)piperidin-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 10211742 |
| Molecular Formula | C38H41F3N4O3 |
| Molecular Weight | 658.77 g/mol |
| Exact Mass | 658.31 |
| IUPAC Name | [2,6-dimethyl-4-(1-oxidopyridin-1-ium-4-yl)phenyl]-[4-methyl-4-[4-(N-[4-(trifluoromethoxy)phenyl]anilino)piperidin-1-yl]piperidin-1-yl]methanone |
| SMILES | Cc1cc(-c2cc[n+]([O-])cc2)cc(C)c1C(=O)N1CCC(C)(N2CCC(N(c3ccccc3)c3ccc(OC(F)(F)F)cc3)CC2)CC1 |
| InChI | InChI=1S/C38H41F3N4O3/c1-27-25-30(29-13-21-44(47)22-14-29)26-28(2)35(27)36(46)42-23-17-37(3,18-24-42)43-19-15-33(16-20-43)45(31-7-5-4-6-8-31)32-9-11-34(12-10-32)48-38(39,40)41/h4-14,21-22,25-26,33H,15-20,23-24H2,1-3H3 |
| InChIKey | SCRUPSNZPGWPEU-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 62.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.77 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|