C19H40N2O4 — CID 102117676
N-[2-[2-[bis(2-hydroxyethyl)amino]ethoxy]butyl]nonanamide (PubChem CID 102117676) has the molecular formula C19H40N2O4 and a molecular weight of 360.54 g/mol. Its IUPAC name is N-[2-[2-[bis(2-hydroxyethyl)amino]ethoxy]butyl]nonanamide.
| Compound Name | N-[2-[2-[bis(2-hydroxyethyl)amino]ethoxy]butyl]nonanamide |
|---|---|
| PubChem CID | 102117676 |
| Molecular Formula | C19H40N2O4 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | N-[2-[2-[bis(2-hydroxyethyl)amino]ethoxy]butyl]nonanamide |
| SMILES | CCCCCCCCC(=O)NCC(CC)OCCN(CCO)CCO |
| InChI | InChI=1S/C19H40N2O4/c1-3-5-6-7-8-9-10-19(24)20-17-18(4-2)25-16-13-21(11-14-22)12-15-23/h18,22-23H,3-17H2,1-2H3,(H,20,24) |
| InChIKey | ZCKKIZSZRFJMCX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|