C15H23NO2S — CID 102119332
N-cyclohexyl-2-(2-methylphenyl)ethanesulfonamide (PubChem CID 102119332) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is N-cyclohexyl-2-(2-methylphenyl)ethanesulfonamide.
| Compound Name | N-cyclohexyl-2-(2-methylphenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 102119332 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-cyclohexyl-2-(2-methylphenyl)ethanesulfonamide |
| SMILES | Cc1ccccc1CCS(=O)(=O)NC1CCCCC1 |
| InChI | InChI=1S/C15H23NO2S/c1-13-7-5-6-8-14(13)11-12-19(17,18)16-15-9-3-2-4-10-15/h5-8,15-16H,2-4,9-12H2,1H3 |
| InChIKey | OANSVLOGSAOHEA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |